ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
98-81-7 alpha-bromostyrene | 
    |
| Nome del prodotto | alpha-bromostyrene | 
| Nome inglese | alpha-bromostyrene;1-(1-Bromovinyl)benzene;(1-bromoethenyl)benzene | 
| Formula molecolare | C8H7Br | 
| Peso Molecolare | 183.0452 | 
| InChI | InChI=1/C8H7Br/c1-7(9)8-5-3-2-4-6-8/h2-6H,1H2 | 
| Numero CAS | 98-81-7 | 
| EINECS | 202-702-4 | 
| Struttura molecolare | ![]()  | 
    
| Densità | 1.387g/cm3 | 
| Punto di fusione | -44℃ | 
| Punto di ebollizione | 212.6°C at 760 mmHg | 
| Indice di rifrazione | 1.574 | 
| Punto d'infiammabilità | 98.3°C | 
| Pressione di vapore | 0.249mmHg at 25°C | 
| Simboli di pericolo | |
| Codici di Rischio | R36/37/38##Irritating to eyes, respiratory system and skin.:; | 
    
| Sicurezza Descrizione | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; | 
    
| MSDS | |