ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
99-14-9 Tricarballylic acid | 
    |
| Nome del prodotto | Tricarballylic acid | 
| Nome inglese | Tricarballylic acid;1,2,3-Propanetricarboxylic acid;3-Carboxyglutaric acid;1,2,3-Propanetricarboxylic acid;propane-1,2,3-tricarboxylic acid | 
| Formula molecolare | C6H8O6 | 
| Peso Molecolare | 176.1241 | 
| InChI | InChI=1/C6H8O6/c7-4(8)1-3(6(11)12)2-5(9)10/h3H,1-2H2,(H,7,8)(H,9,10)(H,11,12) | 
| Numero CAS | 99-14-9 | 
| EINECS | 202-733-3 | 
| Struttura molecolare | ![]()  | 
    
| Densità | 1.574g/cm3 | 
| Punto di fusione | 154-159℃ | 
| Punto di ebollizione | 266.4°C at 760 mmHg | 
| Indice di rifrazione | 1.529 | 
| Punto d'infiammabilità | 129.2°C | 
| Pressione di vapore | 0.00249mmHg at 25°C | 
| Sicurezza Descrizione | S24/25##Avoid contact with skin and eyes.:; | 
    
| MSDS | |