Chemindex > 110-49-6
KR ▼
110-49-6 2-Methoxyethyl acetate |
|
| 상품명칭 | 2-Methoxyethyl acetate |
| 영문 이름 | 2-Methoxyethyl acetate;Methyl Cellosolve?acetate;1-Acetoxy-2-methoxyethane;Ethylene glycol monomethyl ether acetate;Methyl Cellosolve(rg acetate;2-sulfanylethyl acetate |
| 분자식 | C4H8O2S |
| 분자량 | 120.1701 |
| InChI | InChI=1/C4H8O2S/c1-4(5)6-2-3-7/h7H,2-3H2,1H3 |
| cas번호 | 110-49-6 |
| EC번호 | 203-772-9 |
| 분자 구조 |  |
| 밀도 | 1.072g/cm3 |
| 녹는 점 | -65℃ |
| 비등점 | 162.7°C at 760 mmHg |
| 굴절 지수 | 1.452 |
| 인화점 | 57.6°C |
| 증기압 | 2.14mmHg at 25°C |
| 위험성 표시 |  T##Toxic:; |
| 리스크 규칙 | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R60##May impair fertility.||R61##May cause harm to the unborn child.:; |
| 보안 규칙 | S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).||S53##Avoid exposure - obtain special instructions before use.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 