ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
1115-47-5 N-Acetyl-DL-methionine |
|
| 상품명칭 | N-Acetyl-DL-methionine |
| 영문 이름 | N-Acetyl-DL-methionine;Ac-DL-Met-OH;D.L Methionine N, acetyl;N-acetylmethionine;(2R)-2-(acetylamino)-4-(methylsulfanyl)butanoate |
| 분자식 | C7H12NO3S |
| 분자량 | 190.2406 |
| InChI | InChI=1/C7H13NO3S/c1-5(9)8-6(7(10)11)3-4-12-2/h6H,3-4H2,1-2H3,(H,8,9)(H,10,11)/p-1/t6-/m1/s1 |
| cas번호 | 1115-47-5 |
| EC번호 | 214-224-3 |
| 분자 구조 | ![]() |
| 녹는 점 | 117-119℃ |
| 비등점 | 453.6°C at 760 mmHg |
| 인화점 | 228.1°C |
| 증기압 | 1.72E-09mmHg at 25°C |
| 보안 규칙 | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |