ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
1120-06-5 2-Decanol |
|
상품명칭 | 2-Decanol |
영문 이름 | 2-Decanol;Methyl n-octyl carbinol;decan-2-ol;(2S)-decan-2-ol |
분자식 | C10H22O |
분자량 | 158.2811 |
InChI | InChI=1/C10H22O/c1-3-4-5-6-7-8-9-10(2)11/h10-11H,3-9H2,1-2H3/t10-/m0/s1 |
cas번호 | 1120-06-5 |
EC번호 | 214-296-6 |
분자 구조 | ![]() |
밀도 | 0.826g/cm3 |
녹는 점 | -5℃ |
비등점 | 212.2°C at 760 mmHg |
굴절 지수 | 1.434 |
인화점 | 85°C |
증기압 | 0.0393mmHg at 25°C |
보안 규칙 | S24/25##Avoid contact with skin and eyes.:; |
MSDS |