ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
1444-65-1 2-Phenylcyclohexanone |
|
상품명칭 | 2-Phenylcyclohexanone |
영문 이름 | 2-Phenylcyclohexanone;AI3-07036;Cyclohexanone, 2-phenyl-;(2S)-2-phenylcyclohexanone;(2R)-2-phenylcyclohexanone |
분자식 | C12H14O |
분자량 | 174.239 |
InChI | InChI=1/C12H14O/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-3,6-7,11H,4-5,8-9H2/t11-/m1/s1 |
cas번호 | 1444-65-1 |
EC번호 | 215-888-7 |
분자 구조 | ![]() |
밀도 | 1.042g/cm3 |
녹는 점 | 56-59℃ |
비등점 | 294°C at 760 mmHg |
굴절 지수 | 1.537 |
인화점 | 123.7°C |
증기압 | 0.00167mmHg at 25°C |
보안 규칙 | S24/25##Avoid contact with skin and eyes.:; |
MSDS |