ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
161446-90-8 3-Chloro-4-fluorobenzyl alcohol |
|
상품명칭 | 3-Chloro-4-fluorobenzyl alcohol |
영문 이름 | 3-Chloro-4-fluorobenzyl alcohol;(3-chloro-4-fluorophenyl)methanol;3-Chloro-4-fluorobenzyla alcohol |
분자식 | C7H6ClFO |
분자량 | 160.5733 |
InChI | InChI=1/C7H6ClFO/c8-6-3-5(4-10)1-2-7(6)9/h1-3,10H,4H2 |
cas번호 | 161446-90-8 |
분자 구조 | ![]() |
밀도 | 1.344g/cm3 |
비등점 | 242.5°C at 760 mmHg |
굴절 지수 | 1.542 |
인화점 | 100.4°C |
증기압 | 0.0183mmHg at 25°C |
리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |