Chemindex > 161446-90-8
KR ▼
161446-90-8 3-Chloro-4-fluorobenzyl alcohol |
|
| 상품명칭 | 3-Chloro-4-fluorobenzyl alcohol |
| 영문 이름 | 3-Chloro-4-fluorobenzyl alcohol;(3-chloro-4-fluorophenyl)methanol;3-Chloro-4-fluorobenzyla alcohol |
| 분자식 | C7H6ClFO |
| 분자량 | 160.5733 |
| InChI | InChI=1/C7H6ClFO/c8-6-3-5(4-10)1-2-7(6)9/h1-3,10H,4H2 |
| cas번호 | 161446-90-8 |
| 분자 구조 |  |
| 밀도 | 1.344g/cm3 |
| 비등점 | 242.5°C at 760 mmHg |
| 굴절 지수 | 1.542 |
| 인화점 | 100.4°C |
| 증기압 | 0.0183mmHg at 25°C |
| 리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| 보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.ChemNet Mall을 방문하여
3-Chloro-4-fluorobenzyl alcohol 161446-90-8 의 가격에 대해 문의하십시오.
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 