Chemindex > 17351-75-6
KR ▼
17351-75-6 Divinyloxy 1,4-cyclohexanedimethanol |
|
| 상품명칭 | Divinyloxy 1,4-cyclohexanedimethanol |
| 영문 이름 | Divinyloxy 1,4-cyclohexanedimethanol;1,4-Cyclohexanedimethanol divinyl ether,mixture of isomers;1,4-bis(prop-1-en-1-yloxy)cyclohexane;3,5-bis(1-methylethyl)-1H-pyrazole;1,4-Cyclohexan dimethanol divinyl ether |
| 분자식 | C9H16N2 |
| 분자량 | 152.2367 |
| InChI | InChI=1/C9H16N2/c1-6(2)8-5-9(7(3)4)11-10-8/h5-7H,1-4H3,(H,10,11) |
| cas번호 | 17351-75-6 |
| 분자 구조 |  |
| 밀도 | 0.944g/cm3 |
| 녹는 점 | 6℃ |
| 비등점 | 237.3°C at 760 mmHg |
| 굴절 지수 | 1.496 |
| 인화점 | 91.4°C |
| 증기압 | 0.0696mmHg at 25°C |
| 위험성 표시 |  Xi##Irritant||N##Dangerous for the environment:; |
| 리스크 규칙 | R43||R51/53:; |
| 보안 규칙 | S24||S37||S61:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 