ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
17422-32-1 5-Chloroindole |
|
| 상품명칭 | 5-Chloroindole |
| 영문 이름 | 5-Chloroindole;1H-Indole,5-chloro-(9CI); ;5-chloro-1H-indole |
| 분자식 | C8H6ClN |
| 분자량 | 151.5929 |
| InChI | InChI=1/C8H6ClN/c9-7-1-2-8-6(5-7)3-4-10-8/h1-5,10H |
| cas번호 | 17422-32-1 |
| EC번호 | 241-448-9 |
| 분자 구조 | ![]() |
| 밀도 | 1.331g/cm3 |
| 녹는 점 | 69-71℃ |
| 비등점 | 293°C at 760 mmHg |
| 굴절 지수 | 1.688 |
| 인화점 | 158.9°C |
| 증기압 | 0.00309mmHg at 25°C |
| 위험성 표시 | |
| 리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| 보안 규칙 | S22||S24/25:; |
| MSDS | |