ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
2142-70-3 2-Iodoacetophenone |
|
상품명칭 | 2-Iodoacetophenone |
영문 이름 | 2-Iodoacetophenone;2'-iodoacetophenone;1-(2-iodophenyl)ethanone;Iodoacetophenone, 2'- |
분자식 | C8H7IO |
분자량 | 246.045 |
InChI | InChI=1/C8H7IO/c1-6(10)7-4-2-3-5-8(7)9/h2-5H,1H3 |
cas번호 | 2142-70-3 |
분자 구조 | ![]() |
밀도 | 1.72g/cm3 |
비등점 | 268.2°C at 760 mmHg |
굴절 지수 | 1.603 |
인화점 | 116°C |
증기압 | 0.00779mmHg at 25°C |
리스크 규칙 | R36/38##Irritating to eyes and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |