ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
219828-75-8 N'-부틸-N'-페닐아세토히드라지드 |
|
| 상품명칭 | N'-부틸-N'-페닐아세토히드라지드 |
| 영문 이름 | N'-butyl-N'-phenylacetohydrazide; |
| 분자식 | C12H18N2O |
| 분자량 | 206.2841 |
| InChI | InChI=1/C12H18N2O/c1-3-4-10-14(13-11(2)15)12-8-6-5-7-9-12/h5-9H,3-4,10H2,1-2H3,(H,13,15) |
| cas번호 | 219828-75-8 |
| 분자 구조 | ![]() |
| 밀도 | 1.035g/cm3 |
| 굴절 지수 | 1.542 |
| MSDS | |