ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
23165-64-2 2-chloro-4-nitrophenyl isothiocyanate |
|
상품명칭 | 2-chloro-4-nitrophenyl isothiocyanate |
영문 이름 | 2-chloro-4-nitrophenyl isothiocyanate;2-chloro-1-isothiocyanato-4-nitrobenzene |
분자식 | C7H3ClN2O2S |
분자량 | 214.6289 |
InChI | InChI=1/C7H3ClN2O2S/c8-6-3-5(10(11)12)1-2-7(6)9-4-13/h1-3H |
cas번호 | 23165-64-2 |
분자 구조 | ![]() |
밀도 | 1.48g/cm3 |
녹는 점 | 95-99℃ |
비등점 | 354.1°C at 760 mmHg |
굴절 지수 | 1.651 |
인화점 | 167.9°C |
증기압 | 7.01E-05mmHg at 25°C |
리스크 규칙 | R23/24/25##Toxic by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |