ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
24118-21-6 2,5-dichloro-3,6-bis(hydrazino)cyclohexa-2,5-diene-1,4-dione |
|
| 상품명칭 | 2,5-dichloro-3,6-bis(hydrazino)cyclohexa-2,5-diene-1,4-dione |
| 영문 이름 | 2,5-dichloro-3,6-bis(hydrazino)cyclohexa-2,5-diene-1,4-dione; |
| 분자식 | C6H6Cl2N4O2 |
| 분자량 | 237.0434 |
| InChI | InChI=1/C6H6Cl2N4O2/c7-1-3(11-9)6(14)2(8)4(12-10)5(1)13/h11-12H,9-10H2 |
| cas번호 | 24118-21-6 |
| 분자 구조 | ![]() |
| 밀도 | 1.74g/cm3 |
| 비등점 | 420.7°C at 760 mmHg |
| 굴절 지수 | 1.675 |
| 인화점 | 208.2°C |
| 증기압 | 2.77E-07mmHg at 25°C |
| MSDS | |