ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
2423-71-4 2,6-Dimethyl-4-nitrophenol |
|
상품명칭 | 2,6-Dimethyl-4-nitrophenol |
영문 이름 | 2,6-Dimethyl-4-nitrophenol;4-Nitro-2,6-xylenol;2,6-dimethyl-4-nitrophenolate |
분자식 | C8H8NO3 |
분자량 | 166.1546 |
InChI | InChI=1/C8H9NO3/c1-5-3-7(9(11)12)4-6(2)8(5)10/h3-4,10H,1-2H3/p-1 |
cas번호 | 2423-71-4 |
EC번호 | 219-353-9 |
분자 구조 | ![]() |
녹는 점 | 164℃ |
비등점 | 322.8°C at 760 mmHg |
인화점 | 145.3°C |
증기압 | 0.000145mmHg at 25°C |
위험성 표시 | |
리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.||R41##Risks of serious damage to eyes.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |