Chemindex > 2423-71-4
KR ▼
2423-71-4 2,6-Dimethyl-4-nitrophenol |
|
| 상품명칭 | 2,6-Dimethyl-4-nitrophenol |
| 영문 이름 | 2,6-Dimethyl-4-nitrophenol;4-Nitro-2,6-xylenol;2,6-dimethyl-4-nitrophenolate |
| 분자식 | C8H8NO3 |
| 분자량 | 166.1546 |
| InChI | InChI=1/C8H9NO3/c1-5-3-7(9(11)12)4-6(2)8(5)10/h3-4,10H,1-2H3/p-1 |
| cas번호 | 2423-71-4 |
| EC번호 | 219-353-9 |
| 분자 구조 |  |
| 녹는 점 | 164℃ |
| 비등점 | 322.8°C at 760 mmHg |
| 인화점 | 145.3°C |
| 증기압 | 0.000145mmHg at 25°C |
| 위험성 표시 |  Xi##Irritant:; |
| 리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.||R41##Risks of serious damage to eyes.:; |
| 보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 