ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
25726-99-2 3-(디부틸아미노)프로피오니트릴 |
|
상품명칭 | 3-(디부틸아미노)프로피오니트릴 |
별명 | ; 3-(Di-n-butylamino)프로피오니트릴; 3-비스(N-n-부틸)아미노프로피오노니트릴; 3-(디부틸아미노)프로판니트릴; N- 부틸 -N- (2- 시아 노 에틸) 부탄 -1- 아미늄; |
영문 이름 | 3-(Dibutylamino)propionitrile;3-(Di-n-butylamino)propionitrile;3-bis(N-n-butyl)aminopropiononitrile;3-(dibutylamino)propanenitrile;N-butyl-N-(2-cyanoethyl)butan-1-aminium |
분자식 | C11H23N2 |
분자량 | 183.3132 |
InChI | InChI=1/C11H22N2/c1-3-5-9-13(10-6-4-2)11-7-8-12/h3-7,9-11H2,1-2H3/p+1 |
cas번호 | 25726-99-2 |
EC번호 | 247-211-6 |
분자 구조 | ![]() |
비등점 | 287.3°C at 760 mmHg |
인화점 | 110.8°C |
증기압 | 0.00251mmHg at 25°C |
위험성 표시 | |
리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
보안 규칙 | S24/25##Avoid contact with skin and eyes.:; |
MSDS |