Chemindex > 260-94-6
KR ▼
260-94-6 Acridine |
|
| 상품명칭 | Acridine |
| 영문 이름 | Acridine;Dibenzo[b,e]pyridine |
| 분자식 | C13H9N |
| 분자량 | 179.2173 |
| InChI | InChI=1/C13H9N/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h1-9H |
| cas번호 | 260-94-6 |
| EC번호 | 205-971-6 |
| 분자 구조 |  |
| 밀도 | 1.187g/cm3 |
| 녹는 점 | 105-110℃ |
| 비등점 | 346.7°C at 760 mmHg |
| 굴절 지수 | 1.726 |
| 인화점 | 153.8°C |
| 증기압 | 0.000113mmHg at 25°C |
| 위험성 표시 |  Xn##Harmful:; |
| 리스크 규칙 | R22##Harmful if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| 보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 