ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
26315-61-7 (1R)-(-)-Menthyl glyoxylate hydrate |
|
상품명칭 | (1R)-(-)-Menthyl glyoxylate hydrate |
영문 이름 | (1R)-(-)-Menthyl glyoxylate hydrate;Glyoxylic acid (1R)-menthyl ester hydrate;(1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl oxoacetate |
분자식 | C12H20O3 |
분자량 | 212.2854 |
InChI | InChI=1/C12H20O3/c1-8(2)10-5-4-9(3)6-11(10)15-12(14)7-13/h7-11H,4-6H2,1-3H3/t9-,10+,11-/m1/s1 |
cas번호 | 26315-61-7 |
분자 구조 | ![]() |
밀도 | 1g/cm3 |
비등점 | 282°C at 760 mmHg |
굴절 지수 | 1.458 |
인화점 | 116.5°C |
증기압 | 0.00344mmHg at 25°C |
리스크 규칙 | R51/53##Toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.:; |
보안 규칙 | S61##Avoid release to the environment. Refer to special instructions / Safety data sheets.:; |
MSDS |