ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
2719-08-6 Methyl 2-acetamidobenzoate |
|
상품명칭 | Methyl 2-acetamidobenzoate |
영문 이름 | Methyl 2-acetamidobenzoate;methyl 2-(acetylamino)benzoate;Methyl N-acetylanthranilate;ACETYL-N-METHYL-ANTHRANILATE |
분자식 | C10H11NO3 |
분자량 | 193.1992 |
InChI | InChI=1/C10H11NO3/c1-7(12)11-9-6-4-3-5-8(9)10(13)14-2/h3-6H,1-2H3,(H,11,12) |
cas번호 | 2719-08-6 |
EC번호 | 220-318-5 |
분자 구조 | ![]() |
밀도 | 1.204g/cm3 |
녹는 점 | 97-101℃ |
비등점 | 376.3°C at 760 mmHg |
굴절 지수 | 1.565 |
인화점 | 181.4°C |
증기압 | 7.3E-06mmHg at 25°C |
보안 규칙 | S24/25##Avoid contact with skin and eyes.:; |
MSDS |