ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
33018-91-6 Monoethylpimelate |
|
| 상품명칭 | Monoethylpimelate |
| 영문 이름 | Monoethylpimelate;Ethyl hydrogen pimelate;Heptanedioic acid monoethyl ester;Monoethyl pimelate;Pimelic acid monoethyl ester;Ethylhydrogenpimelate;Pimelicacidmonoethylester;7-ethoxy-7-oxoheptanoic acid;Boc-His(Tos)-Merrifield resin |
| 분자식 | C9H16O4 |
| 분자량 | 188.2209 |
| InChI | InChI=1/C9H16O4/c1-2-13-9(12)7-5-3-4-6-8(10)11/h2-7H2,1H3,(H,10,11) |
| cas번호 | 33018-91-6 |
| EC번호 | 251-346-6 |
| 분자 구조 | ![]() |
| 밀도 | 1.074g/cm3 |
| 비등점 | 288.7°C at 760 mmHg |
| 굴절 지수 | 1.449 |
| 인화점 | 108°C |
| 증기압 | 0.000581mmHg at 25°C |
| 리스크 규칙 | R36/38##Irritating to eyes and skin.:; |
| 보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |