ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
331-62-4 3-fluoro-4-methoxybenzonitrile |
|
| 상품명칭 | 3-fluoro-4-methoxybenzonitrile |
| 영문 이름 | 3-fluoro-4-methoxybenzonitrile;Fluoromethoxybenzonitrile |
| 분자식 | C8H6FNO |
| 분자량 | 151.1377 |
| InChI | InChI=1/C8H6FNO/c1-11-8-3-2-6(5-10)4-7(8)9/h2-4H,1H3 |
| cas번호 | 331-62-4 |
| 분자 구조 | ![]() |
| 밀도 | 1.18g/cm3 |
| 비등점 | 254.3°C at 760 mmHg |
| 굴절 지수 | 1.505 |
| 인화점 | 107.6°C |
| 증기압 | 0.0173mmHg at 25°C |
| 리스크 규칙 | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| 보안 규칙 | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
| MSDS | |