ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
333408-44-9 (2-클로로-6,7-디메틸퀴놀린-3-일)메탄올 |
|
| 상품명칭 | (2-클로로-6,7-디메틸퀴놀린-3-일)메탄올 |
| 별명 | ;(2-클로로-6,7-디메틸-3-퀴놀리닐)메탄올; (2-클로로-6,7-디메틸퀴놀린-3-일)메탄올; (2-클로로-6,7-디메틸-퀴놀린-3-일)-메탄올; 3-퀴놀린메탄올, 2-클로로-6,7-디메틸-; |
| 영문 이름 | (2-chloro-6,7-dimethylquinolin-3-yl)methanol;(2-chloro-6,7-dimethyl-3-quinolinyl)methanol;(2-Chloro-6,7-dimethylquinolin-3-yl)methanol;(2-Chloro-6,7-dimethyl-quinolin-3-yl)-methanol;3-quinolinemethanol, 2-chloro-6,7-dimethyl- |
| 분자식 | C12H12ClNO |
| 분자량 | 221.6828 |
| InChI | InChI=1/C12H12ClNO/c1-7-3-9-5-10(6-15)12(13)14-11(9)4-8(7)2/h3-5,15H,6H2,1-2H3 |
| cas번호 | 333408-44-9 |
| 분자 구조 | ![]() |
| 밀도 | 1.266g/cm3 |
| 비등점 | 387.9°C at 760 mmHg |
| 굴절 지수 | 1.641 |
| 인화점 | 188.4°C |
| 증기압 | 1.03E-06mmHg at 25°C |
| MSDS | |