ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
3389-57-9 4-테트라하이드로-1H-피롤-1-일펜트-3-엔-2-온 |
|
상품명칭 | 4-테트라하이드로-1H-피롤-1-일펜트-3-엔-2-온 |
별명 | 4-(피롤리딘-1-일)펜트-3-엔-2-온; (3E)-4-피롤리딘-1-일펜트-3-엔-2-온; (3Z)-4-피롤리딘-1-일펜트-3-엔-2-온; |
영문 이름 | 4-tetrahydro-1H-pyrrol-1-ylpent-3-en-2-one;4-(pyrrolidin-1-yl)pent-3-en-2-one;(3E)-4-pyrrolidin-1-ylpent-3-en-2-one;(3Z)-4-pyrrolidin-1-ylpent-3-en-2-one |
분자식 | C9H15NO |
분자량 | 153.2215 |
InChI | InChI=1/C9H15NO/c1-8(7-9(2)11)10-5-3-4-6-10/h7H,3-6H2,1-2H3/b8-7- |
cas번호 | 3389-57-9 |
분자 구조 | ![]() |
밀도 | 0.995g/cm3 |
녹는 점 | 114℃ |
비등점 | 248.4°C at 760 mmHg |
굴절 지수 | 1.496 |
인화점 | 88.2°C |
증기압 | 0.0243mmHg at 25°C |
위험성 표시 | |
리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |