ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
3440-24-2 3',4',7,8-테트라하이드록시플라본 |
|
상품명칭 | 3',4',7,8-테트라하이드록시플라본 |
별명 | 2-(3,4-디히드록시페닐)-7,8-디히드록시-4H-크로멘-4-온; |
영문 이름 | 3',4',7,8-Tetrahydroxyflavone;2-(3,4-dihydroxyphenyl)-7,8-dihydroxy-4H-chromen-4-one |
분자식 | C15H10O6 |
분자량 | 286.2363 |
InChI | InChI=1/C15H10O6/c16-9-3-1-7(5-12(9)19)13-6-11(18)8-2-4-10(17)14(20)15(8)21-13/h1-6,16-17,19-20H |
cas번호 | 3440-24-2 |
분자 구조 | ![]() |
밀도 | 1.654g/cm3 |
비등점 | 618.9°C at 760 mmHg |
굴절 지수 | 1.767 |
인화점 | 240.6°C |
증기압 | 6.57E-16mmHg at 25°C |
리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |