Chemindex > 370-81-0
KR ▼
370-81-0 Oxalic acid bis(cyclohexylidenehydrazide) |
|
| 상품명칭 | Oxalic acid bis(cyclohexylidenehydrazide) |
| 영문 이름 | Oxalic acid bis(cyclohexylidenehydrazide);Cuprizon 1;Bis(cyclohexanone)oxaldihydrazone;oxalic bis(cyclohexylidenehydrazide);N,N-oxalylbis(cyclohexanone hydrazone);Cuprizon l;cuprizon;Oxalic acid bis (cyclohexylidenehydrazide);N'~1~,N'~2~-dicyclohexylideneethanedihydrazide |
| 분자식 | C14H22N4O2 |
| 분자량 | 278.3501 |
| InChI | InChI=1/C14H22N4O2/c19-13(17-15-11-7-3-1-4-8-11)14(20)18-16-12-9-5-2-6-10-12/h1-10H2,(H,17,19)(H,18,20) |
| cas번호 | 370-81-0 |
| EC번호 | 206-729-2 |
| 분자 구조 |  |
| 밀도 | 1.29g/cm3 |
| 녹는 점 | 208-214℃ |
| 굴절 지수 | 1.625 |
| 위험성 표시 |  Xn##Harmful:; |
| 리스크 규칙 | R21/22##Harmful in contact with skin and if swallowed.:; |
| 보안 규칙 | S2##Keep out of reach of children||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.ChemNet Mall을 방문하여
Oxalic acid bis(cyclohexylidenehydrazide) 370-81-0 의 가격에 대해 문의하십시오.
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 