Chemindex > 37904-84-0
KR ▼
37904-84-0 2,6-diphenylcyclohexanone, mixture of cis an |
|
| 상품명칭 | 2,6-diphenylcyclohexanone, mixture of cis an |
| 영문 이름 | 2,6-diphenylcyclohexanone, mixture of cis an; |
| 분자식 | C18H18O |
| 분자량 | 250.3349 |
| InChI | InChI=1/C18H18O/c19-18-16(14-8-3-1-4-9-14)12-7-13-17(18)15-10-5-2-6-11-15/h1-6,8-11,16-17H,7,12-13H2 |
| cas번호 | 37904-84-0 |
| 분자 구조 |  |
| 밀도 | 1.082g/cm3 |
| 녹는 점 | 119-121℃ |
| 비등점 | 405.3°C at 760 mmHg |
| 굴절 지수 | 1.577 |
| 인화점 | 177.4°C |
| 증기압 | 8.85E-07mmHg at 25°C |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
37904-84-0 (0) 공급 업체:
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 