ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
37989-92-7 1-(2'-플루오로[1,1'-비페닐]-4-일)프로판-1-온 |
|
상품명칭 | 1-(2'-플루오로[1,1'-비페닐]-4-일)프로판-1-온 |
별명 | 1-(2'-플루오로비페닐-4-일)프로판-1-온; |
영문 이름 | 1-(2'-fluoro[1,1'-biphenyl]-4-yl)propan-1-one;1-(2'-fluorobiphenyl-4-yl)propan-1-one |
분자식 | C15H13FO |
분자량 | 228.2615 |
InChI | InChI=1/C15H13FO/c1-2-15(17)12-9-7-11(8-10-12)13-5-3-4-6-14(13)16/h3-10H,2H2,1H3 |
cas번호 | 37989-92-7 |
분자 구조 | ![]() |
밀도 | 1.102g/cm3 |
비등점 | 334.1°C at 760 mmHg |
굴절 지수 | 1.545 |
인화점 | 138.5°C |
증기압 | 0.000131mmHg at 25°C |
보안 규칙 | S24/25##Avoid contact with skin and eyes.:; |
MSDS |