ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
39232-91-2 3-Methoxyphenylhydrazine hydrochloride |
|
| 상품명칭 | 3-Methoxyphenylhydrazine hydrochloride |
| 영문 이름 | 3-Methoxyphenylhydrazine hydrochloride;3-Methoxyphenylhydrazine HCl;(3-methoxyphenyl)hydrazine;m-Methoxyphenylhydrazine hydrochloride;(3-Methoxy-phenyl)-hydrazine HCl |
| 분자식 | C7H11ClN2O |
| 분자량 | 174.628 |
| InChI | InChI=1/C7H10N2O.ClH/c1-10-7-4-2-3-6(5-7)9-8;/h2-5,9H,8H2,1H3;1H |
| cas번호 | 39232-91-2 |
| EC번호 | 254-368-4 |
| 분자 구조 | ![]() |
| 비등점 | 275.3°C at 760 mmHg |
| 인화점 | 120.3°C |
| 증기압 | 0.00515mmHg at 25°C |
| 리스크 규칙 | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| 보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |