ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
39828-35-8 2,4- dimethoxybenzoyl chloride |
|
상품명칭 | 2,4- dimethoxybenzoyl chloride |
영문 이름 | 2,4- dimethoxybenzoyl chloride;2,4-DIMETHOXYBENZOYL CHLORIDE;benzoyl chloride, 2,4-dimethoxy- |
분자식 | C9H9ClO3 |
분자량 | 200.619 |
InChI | InChI=1/C9H9ClO3/c1-12-6-3-4-7(9(10)11)8(5-6)13-2/h3-5H,1-2H3 |
cas번호 | 39828-35-8 |
분자 구조 | ![]() |
밀도 | 1.224g/cm3 |
녹는 점 | 58℃ |
비등점 | 306.7°C at 760 mmHg |
굴절 지수 | 1.52 |
인화점 | 134.1°C |
증기압 | 0.000757mmHg at 25°C |
위험성 표시 | |
리스크 규칙 | R34##Causes burns.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |