ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
402-63-1 1-(3-fluorophenyl)ethanol |
|
| 상품명칭 | 1-(3-fluorophenyl)ethanol |
| 영문 이름 | 1-(3-fluorophenyl)ethanol;3-fluorophenyl methyl carbinol;3-Fluoro-alpha-methylbenzyl alcohol~3-Fluorophenyl methyl carbinol;3-Fluoro-α-methylbenzenemethanol |
| 분자식 | C8H9FO |
| 분자량 | 140.1549 |
| InChI | InChI=1/C8H9FO/c1-6(10)7-3-2-4-8(9)5-7/h2-6,10H,1H3 |
| cas번호 | 402-63-1 |
| EC번호 | 206-950-4 |
| 분자 구조 | ![]() |
| 밀도 | 1.123g/cm3 |
| 비등점 | 196.2°C at 760 mmHg |
| 굴절 지수 | 1.51 |
| 인화점 | 90.1°C |
| 증기압 | 0.251mmHg at 25°C |
| 보안 규칙 | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |