Chemindex > 403-15-6
KR ▼
403-15-6 4-Fluoro-3-methylbenzoic acid |
|
| 상품명칭 | 4-Fluoro-3-methylbenzoic acid |
| 영문 이름 | 4-Fluoro-3-methylbenzoic acid;4-Fluoro-m-toluic acid;4-fluoro-3-methylbenzoate;3-methyl-4-Fluorobenzoic acid; |
| 분자식 | C8H6FO2 |
| 분자량 | 153.131 |
| InChI | InChI=1/C8H7FO2/c1-5-4-6(8(10)11)2-3-7(5)9/h2-4H,1H3,(H,10,11)/p-1 |
| cas번호 | 403-15-6 |
| 분자 구조 |  |
| 녹는 점 | 166-169℃ |
| 비등점 | 266.3°C at 760 mmHg |
| 인화점 | 114.9°C |
| 증기압 | 0.00434mmHg at 25°C |
| 리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| 보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 