ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
49719-60-0 트리스 (2- 하이드 록시 에틸) 암모늄 팔미테이트 |
|
| 상품명칭 | 트리스 (2- 하이드 록시 에틸) 암모늄 팔미테이트 |
| 별명 | 헥사데카노산, compd.with 2,2',2''-니트릴로트리스(에탄올)(1:1); 차 팔미틴산염; 트리에탄올아민 팔미테이트; 팔미트산, 트리에탄올아민염; 헥사데카노산, compd.2,2',2''-니트로트리스(에탄올)(1:1); 트리스 (2- 히드 록시 에틸) 팔미틴산 암모늄; 헥사 데 카노산 - 2,2 ', 2''- 니트릴로 트리에탄올 (1 : 1); |
| 영문 이름 | tris(2-hydroxyethyl)ammonium palmitate;Hexadecanoic acid, compd. with 2,2',2''-nitrilotris(ethanol) (1:1);TEA-Palmitate;Triethanolamine palmitate;Palmitic acid, triethanolamine salt;Hexadecanoic acid, compd. with 2,2',2''-nitrotris(ethanol) (1:1);Tris(2-hydroxyethyl)ammonium palmitate;hexadecanoic acid - 2,2',2''-nitrilotriethanol (1:1) |
| 분자식 | C22H47NO5 |
| 분자량 | 405.6123 |
| InChI | InChI=1/C16H32O2.C6H15NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;8-4-1-7(2-5-9)3-6-10/h2-15H2,1H3,(H,17,18);8-10H,1-6H2 |
| cas번호 | 49719-60-0 |
| EC번호 | 256-444-2 |
| 분자 구조 | ![]() |
| 비등점 | 340.6°C at 760 mmHg |
| 인화점 | 154.1°C |
| 증기압 | 3.28E-05mmHg at 25°C |
| MSDS | |