Chemindex > 501014-44-4
KR ▼
501014-44-4 2-Indanylboronic acid diethanolamine cyclic ester |
|
| 상품명칭 | 2-Indanylboronic acid diethanolamine cyclic ester |
| 영문 이름 | 2-Indanylboronic acid diethanolamine cyclic ester;2-(2,3-dihydro-1H-inden-2-yl)-1,3,6,2-dioxazaborocane |
| 분자식 | C13H18BNO2 |
| 분자량 | 231.0985 |
| InChI | InChI=1/C13H18BNO2/c1-2-4-12-10-13(9-11(12)3-1)14-16-7-5-15-6-8-17-14/h1-4,13,15H,5-10H2 |
| cas번호 | 501014-44-4 |
| 분자 구조 |  |
| 밀도 | 1.101g/cm3 |
| 비등점 | 350.733°C at 760 mmHg |
| 굴절 지수 | 1.538 |
| 인화점 | 165.917°C |
| 증기압 | 0mmHg at 25°C |
| 리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| 보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
501014-44-4 (0) 공급 업체:
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 