Chemindex > 502-50-1
KR ▼
502-50-1 4-Ketopimelic acid |
|
| 상품명칭 | 4-Ketopimelic acid |
| 영문 이름 | 4-Ketopimelic acid;4-Oxopimelic acid;4-oxoheptanedioic acid;4-oxoheptanedioate |
| 분자식 | C7H8O5 |
| 분자량 | 172.1365 |
| InChI | InChI=1/C7H10O5/c8-5(1-3-6(9)10)2-4-7(11)12/h1-4H2,(H,9,10)(H,11,12)/p-2 |
| cas번호 | 502-50-1 |
| EC번호 | 207-941-8 |
| 분자 구조 |  |
| 녹는 점 | 142-144℃ |
| 비등점 | 420.4°C at 760 mmHg |
| 인화점 | 222.2°C |
| 증기압 | 3.03E-08mmHg at 25°C |
| 위험성 표시 |  Xi##Irritant:; |
| 리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| 보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 