ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
5084-80-0 tris(4-methylphenyl)boroxin |
|
| 상품명칭 | tris(4-methylphenyl)boroxin |
| 영문 이름 | tris(4-methylphenyl)boroxin;2,4,6-Tris(4-methylphenyl)boroxin;boroxin, 2,4,6-tris(4-methylphenyl)-;Boroxin, tris(4-methylphenyl)- |
| 분자식 | C21H21B3O3 |
| 분자량 | 353.8226 |
| InChI | InChI=1/C21H21B3O3/c1-16-4-10-19(11-5-16)22-25-23(20-12-6-17(2)7-13-20)27-24(26-22)21-14-8-18(3)9-15-21/h4-15H,1-3H3 |
| cas번호 | 5084-80-0 |
| 분자 구조 | ![]() |
| 밀도 | 1.09g/cm3 |
| 비등점 | 408.9°C at 760 mmHg |
| 굴절 지수 | 1.555 |
| 인화점 | 201.1°C |
| 증기압 | 1.6E-06mmHg at 25°C |
| MSDS | |