ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
524-35-6 2-암모니오-6,9-디하이드로-7,9-디메틸-6-옥소-1H-퓨리늄 |
|
| 상품명칭 | 2-암모니오-6,9-디하이드로-7,9-디메틸-6-옥소-1H-퓨리늄 |
| 별명 | 2-암모니오-6,9-디하이드로-7,9-디메틸-6-옥소-1H-퓨리늄; 2- 아미노 -7,9- 디메틸 -6- 옥소 -6,7- 디 하이드로 -3H- 퓨린 -9- 이움; |
| 영문 이름 | 2-ammonio-6,9-dihydro-7,9-dimethyl-6-oxo-1H-purinium;2-Ammonio-6,9-dihydro-7,9-dimethyl-6-oxo-1H-purinium;2-amino-7,9-dimethyl-6-oxo-6,7-dihydro-3H-purin-9-ium |
| 분자식 | C7H10N5O |
| 분자량 | 180.1867 |
| InChI | InChI=1/C7H9N5O/c1-11-3-12(2)5-4(11)6(13)10-7(8)9-5/h3H,1-2H3,(H2-,8,9,10,13)/p+1 |
| cas번호 | 524-35-6 |
| EC번호 | 208-356-0 |
| 분자 구조 | ![]() |
| MSDS | |