ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
5762-27-6 1-oxo-3,4-dihydro-1H-isochromene-3-carboxylic acid |
|
| 상품명칭 | 1-oxo-3,4-dihydro-1H-isochromene-3-carboxylic acid |
| 영문 이름 | 1-oxo-3,4-dihydro-1H-isochromene-3-carboxylic acid;1H-2-Benzopyran-3-carboxylic acid, 3,4-dihydro-1-oxo-;1-Oxo-3,4-dihydro-1H-isochromene-3-carboxylic acid |
| 분자식 | C10H8O4 |
| 분자량 | 192.1681 |
| InChI | InChI=1/C10H8O4/c11-9(12)8-5-6-3-1-2-4-7(6)10(13)14-8/h1-4,8H,5H2,(H,11,12) |
| cas번호 | 5762-27-6 |
| 분자 구조 | ![]() |
| 밀도 | 1.412g/cm3 |
| 비등점 | 471.5°C at 760 mmHg |
| 굴절 지수 | 1.595 |
| 인화점 | 197.6°C |
| 증기압 | 1.07E-09mmHg at 25°C |
| MSDS | |