ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
| 618-76-8 4-hydroxy-3,5-diiodobenzoic acid | |
| 상품명칭 | 4-hydroxy-3,5-diiodobenzoic acid | 
| 영문 이름 | 4-hydroxy-3,5-diiodobenzoic acid;3,5-Diiodo-4-hydroxybenzoic acid | 
| 분자식 | C7H4I2O3 | 
| 분자량 | 389.9138 | 
| InChI | InChI=1/C7H4I2O3/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1-2,10H,(H,11,12) | 
| cas번호 | 618-76-8 | 
| EC번호 | 210-562-0 | 
| 분자 구조 |  | 
| 밀도 | 2.697g/cm3 | 
| 비등점 | 346.4°C at 760 mmHg | 
| 굴절 지수 | 1.784 | 
| 인화점 | 163.3°C | 
| 증기압 | 2.19E-05mmHg at 25°C | 
| 리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; | 
| 보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; | 
| MSDS | |