ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
623-37-0 3-Hexanol |
|
| 상품명칭 | 3-Hexanol |
| 영문 이름 | 3-Hexanol;3-Hexyl alcohol;Ethyl propyl carbinol;FEMA No. 3351;NSC 60708;hexan-3-ol;(3S)-hexan-3-ol;(3R)-hexan-3-ol |
| 분자식 | C6H14O |
| 분자량 | 102.1748 |
| InChI | InChI=1/C6H14O/c1-3-5-6(7)4-2/h6-7H,3-5H2,1-2H3/t6-/m1/s1 |
| cas번호 | 623-37-0 |
| EC번호 | 210-790-0 |
| 분자 구조 | ![]() |
| 밀도 | 0.814g/cm3 |
| 비등점 | 135°C at 760 mmHg |
| 굴절 지수 | 1.413 |
| 인화점 | 41.7°C |
| 증기압 | 3.39mmHg at 25°C |
| 위험성 표시 | |
| 리스크 규칙 | R10##Flammable.||R22##Harmful if swallowed.:; |
| 보안 규칙 | S16##Keep away from sources of ignition - No smoking.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |