ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
6269-57-4 3- [2- (4- 페닐 피페라 진 -1- 일) 에톡시] 프로판 니트릴 |
|
| 상품명칭 | 3- [2- (4- 페닐 피페라 진 -1- 일) 에톡시] 프로판 니트릴 |
| 별명 | ; |
| 영문 이름 | 3-[2-(4-phenylpiperazin-1-yl)ethoxy]propanenitrile; |
| 분자식 | C15H21N3O |
| 분자량 | 259.3467 |
| InChI | InChI=1/C15H21N3O/c16-7-4-13-19-14-12-17-8-10-18(11-9-17)15-5-2-1-3-6-15/h1-3,5-6H,4,8-14H2 |
| cas번호 | 6269-57-4 |
| 분자 구조 | ![]() |
| 밀도 | 1.082g/cm3 |
| 비등점 | 431.3°C at 760 mmHg |
| 굴절 지수 | 1.537 |
| 인화점 | 214.6°C |
| 증기압 | 1.21E-07mmHg at 25°C |
| MSDS | |