ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
6282-68-4 벤질 6-시클로헥실헥사노에이트 |
|
| 상품명칭 | 벤질 6-시클로헥실헥사노에이트 |
| 별명 | ; |
| 영문 이름 | benzyl 6-cyclohexylhexanoate; |
| 분자식 | C19H28O2 |
| 분자량 | 288.4244 |
| InChI | InChI=1/C19H28O2/c20-19(21-16-18-13-7-2-8-14-18)15-9-3-6-12-17-10-4-1-5-11-17/h2,7-8,13-14,17H,1,3-6,9-12,15-16H2 |
| cas번호 | 6282-68-4 |
| 분자 구조 | ![]() |
| 밀도 | 0.992g/cm3 |
| 비등점 | 386.5°C at 760 mmHg |
| 굴절 지수 | 1.506 |
| 인화점 | 123.5°C |
| 증기압 | 3.51E-06mmHg at 25°C |
| MSDS | |