ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
6368-72-5 Sudan Red 7B |
|
상품명칭 | Sudan Red 7B |
영문 이름 | Sudan Red 7B;C.I. 26050;C.I. 26,050;C.I. Solvent Red 19;C.I. Solvent Red 19 (8CI);Fat Red 7B;N-Ethyl-1-[4-(phenylazo)phenylazo]-2-naphthylamine;Solvent Red 19;sudan red 7B (C.I. 26050);fat red bluish;N-ethyl-1-(4-(phenylazo)phenylazo)-2-naphthylamine;Oil violet;N-ethyl-1-[(E)-{4-[(E)-phenyldiazenyl]phenyl}diazenyl]naphthalen-2-amine |
분자식 | C24H21N5 |
분자량 | 379.457 |
InChI | InChI=1/C24H21N5/c1-2-25-23-17-12-18-8-6-7-11-22(18)24(23)29-28-21-15-13-20(14-16-21)27-26-19-9-4-3-5-10-19/h3-17,25H,2H2,1H3/b27-26+,29-28+ |
cas번호 | 6368-72-5 |
EC번호 | 228-862-5 |
분자 구조 | ![]() |
밀도 | 1.15g/cm3 |
녹는 점 | 130℃ |
비등점 | 606.6°C at 760 mmHg |
굴절 지수 | 1.64 |
인화점 | 320.7°C |
증기압 | 1.15E-14mmHg at 25°C |
위험성 표시 | |
리스크 규칙 | R40##Possible risks of irreversible effects.:; |
보안 규칙 | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |