ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
63868-89-3 2-{[(4-메틸피페라진-1-일)메틸]설파닐}에탄티올 |
|
| 상품명칭 | 2-{[(4-메틸피페라진-1-일)메틸]설파닐}에탄티올 |
| 별명 | ; |
| 영문 이름 | 2-{[(4-methylpiperazin-1-yl)methyl]sulfanyl}ethanethiol; |
| 분자식 | C8H18N2S2 |
| 분자량 | 206.3719 |
| InChI | InChI=1/C8H18N2S2/c1-9-2-4-10(5-3-9)8-12-7-6-11/h11H,2-8H2,1H3 |
| cas번호 | 63868-89-3 |
| 분자 구조 | ![]() |
| 밀도 | 1.082g/cm3 |
| 비등점 | 291.7°C at 760 mmHg |
| 굴절 지수 | 1.543 |
| 인화점 | 130.2°C |
| 증기압 | 0.00192mmHg at 25°C |
| MSDS | |