Chemindex > 65122-45-4
KR ▼
65122-45-4 포름산, 4-[(m-aminophenyl)azo]벤젠-1,3-디아민(1:1)과 화합물 |
|
| 상품명칭 | 포름산, 4-[(m-aminophenyl)azo]벤젠-1,3-디아민(1:1)과 화합물 |
| 별명 | 포름산, compd.4-(2-(3-아미노페닐)디아제닐)-1,3-벤젠디아민(1:1); m- 페닐 렌 디아민, 4- ((m- 아미노 페닐) 아조) -, 모노 포름산염; 포름산, compd.4-((3-아미노페닐)아조)-1,3-벤젠디아민(1:1); 포름산, 4-((m-아미노페닐)아조)벤젠-1,3-디아민(1:1)과 화합물; 포름산 - 4- [(E) - (3- 아미노 페닐) 디아 제닐] 벤젠 -1,3- 디아민 (1 : 1); |
| 영문 이름 | formic acid, compound with 4-[(m-aminophenyl)azo]benzene-1,3-diamine (1:1);Formic acid, compd. with 4-(2-(3-aminophenyl)diazenyl)-1,3-benzenediamine (1:1);m-Phenylenediamine, 4-((m-aminophenyl)azo)-, monoformate;Formic acid, compd. with 4-((3-aminophenyl)azo)-1,3-benzenediamine (1:1);Formic acid, compound with 4-((m-aminophenyl)azo)benzene-1,3-diamine (1:1);formic acid - 4-[(E)-(3-aminophenyl)diazenyl]benzene-1,3-diamine (1:1) |
| 분자식 | C13H15N5O2 |
| 분자량 | 273.2905 |
| InChI | InChI=1/C12H13N5.CH2O2/c13-8-2-1-3-10(6-8)16-17-12-5-4-9(14)7-11(12)15;2-1-3/h1-7H,13-15H2;1H,(H,2,3)/b17-16+; |
| cas번호 | 65122-45-4 |
| EC번호 | 265-490-2 |
| 분자 구조 | ![65122-45-4 포름산, 4-[(m-aminophenyl)azo]벤젠-1,3-디아민(1:1)과 화합물](https://images-a.chemnet.com/suppliers/chembase/cas6/cas65122-45-4.gif "65122-45-4 포름산, 4-[(m-aminophenyl)azo]벤젠-1,3-디아민(1:1)과 화합물") |
| 비등점 | 521.3°C at 760 mmHg |
| 인화점 | 269.1°C |
| 증기압 | 5.76E-11mmHg at 25°C |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
65122-45-4 (0) 공급 업체:
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 