ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
658692-16-1 Benzenemethanamine, N,N-bis(3-phosphinopropyl)- |
|
| 상품명칭 | Benzenemethanamine, N,N-bis(3-phosphinopropyl)- |
| 영문 이름 | Benzenemethanamine, N,N-bis(3-phosphinopropyl)-; |
| 분자식 | C13H23NP2 |
| cas번호 | 658692-16-1 |
| 분자 구조 | ![]() |
| MSDS | |