ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
70624-19-0 potassium 2-{[2,4-bis(dimethylamino)phenyl][4-(dimethylamino)phenyl]methyl}-5-(dimethylamino)benzoate |
|
| 상품명칭 | potassium 2-{[2,4-bis(dimethylamino)phenyl][4-(dimethylamino)phenyl]methyl}-5-(dimethylamino)benzoate |
| 영문 이름 | potassium 2-{[2,4-bis(dimethylamino)phenyl][4-(dimethylamino)phenyl]methyl}-5-(dimethylamino)benzoate;benzoic acid, 2-[[2,4-bis(dimethylamino)phenyl][4-(dimethylamino)phenyl]methyl]-5-(dimethylamino)-, potassium salt (1:1);Potassium 2-{[2,4-bis(dimethylamino)phenyl][4-(dimethylamino)phenyl]methyl}-5-(dimethylamino)benzoate |
| 분자식 | C28H35KN4O2 |
| 분자량 | 498.7014 |
| InChI | InChI=1/C28H36N4O2.K/c1-29(2)20-11-9-19(10-12-20)27(23-15-13-21(30(3)4)17-25(23)28(33)34)24-16-14-22(31(5)6)18-26(24)32(7)8;/h9-18,27H,1-8H3,(H,33,34);/q;+1/p-1 |
| cas번호 | 70624-19-0 |
| 분자 구조 | ![]() |
| 비등점 | 664.7°C at 760 mmHg |
| 인화점 | 355.8°C |
| 증기압 | 1.41E-18mmHg at 25°C |
| MSDS | |