ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
72-54-8 2,2-Bis(4-chlorophenyl)-1,1-dichloroethane |
|
| 상품명칭 | 2,2-Bis(4-chlorophenyl)-1,1-dichloroethane |
| 영문 이름 | 2,2-Bis(4-chlorophenyl)-1,1-dichloroethane; |
| 분자식 | C14H10Cl4 |
| 분자량 | 320.04 |
| InChI | InChI=1/C14H10Cl4/c15-11-5-1-9(2-6-11)13(14(17)18)10-3-7-12(16)8-4-10/h1-8,13-14H |
| cas번호 | 72-54-8 |
| EC번호 | 200-783-0 |
| 분자 구조 | ![]() |
| 녹는 점 | 109-111℃ |
| 위험성 표시 | |
| 리스크 규칙 | R23/24/25##Toxic by inhalation, in contact with skin and if swallowed.:; |
| 보안 규칙 | S23##Do not inhale gas/fumes/vapour/spray.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |