ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
7228-54-8 망간(2 ) 2,2'-{시클로헥산-1,2-디일비스[니트릴로(E)메틸릴리덴]}비스피페리딘-1-ide-퍼클로르산(1:2) |
|
| 상품명칭 | 망간(2 ) 2,2'-{시클로헥산-1,2-디일비스[니트릴로(E)메틸릴리덴]}비스피페리딘-1-ide-퍼클로르산(1:2) |
| 별명 | ; |
| 영문 이름 | manganese(2+) 2,2'-{cyclohexane-1,2-diylbis[nitrilo(E)methylylidene]}bispiperidin-1-ide - perchloric acid (1:2); |
| 분자식 | C18H32Cl2MnN4O8 |
| 분자량 | 558.3127 |
| InChI | InChI=1/C18H30N4.2ClHO4.Mn/c1-2-10-18(22-14-16-8-4-6-12-20-16)17(9-1)21-13-15-7-3-5-11-19-15;2*2-1(3,4)5;/h13-18H,1-12H2;2*(H,2,3,4,5);/q-2;;;+2/b21-13+,22-14+;;; |
| cas번호 | 7228-54-8 |
| 분자 구조 | ![]() |
| 비등점 | 489°C at 760 mmHg |
| 인화점 | 249.5°C |
| 증기압 | 1.04E-09mmHg at 25°C |
| MSDS | |