ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
74101-58-9 7-chloro-3-(3,5-dimethylphenyl)-2-methylquinazolin-4(3H)-one |
|
| 상품명칭 | 7-chloro-3-(3,5-dimethylphenyl)-2-methylquinazolin-4(3H)-one |
| 영문 이름 | 7-chloro-3-(3,5-dimethylphenyl)-2-methylquinazolin-4(3H)-one;4(3H)-Quinazolinone, 7-chloro-3-(3,5-dimethylphenyl)-2-methyl- |
| 분자식 | C17H15ClN2O |
| 분자량 | 298.7668 |
| InChI | InChI=1/C17H15ClN2O/c1-10-6-11(2)8-14(7-10)20-12(3)19-16-9-13(18)4-5-15(16)17(20)21/h4-9H,1-3H3 |
| cas번호 | 74101-58-9 |
| 분자 구조 | ![]() |
| 밀도 | 1.24g/cm3 |
| 비등점 | 475.2°C at 760 mmHg |
| 굴절 지수 | 1.627 |
| 인화점 | 241.2°C |
| 증기압 | 3.38E-09mmHg at 25°C |
| MSDS | |