ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
75214-12-9 메틸 3- 아미노 -4- [(1- 벤질 -2- 메 톡시 -2- 옥소 에틸) 아미노] -4- 옥소 부타 노 에이트 염산염 |
|
상품명칭 | 메틸 3- 아미노 -4- [(1- 벤질 -2- 메 톡시 -2- 옥소 에틸) 아미노] -4- 옥소 부타 노 에이트 염산염 |
별명 | 메틸 (3S)-3-아미노-4-{[(1R)-1-벤질-2-메톡시-2-옥소에틸]아미노}-4-옥소부타노에이트 염산염 (비바람직한 명칭); |
영문 이름 | methyl 3-amino-4-[(1-benzyl-2-methoxy-2-oxoethyl)amino]-4-oxobutanoate hydrochloride;methyl (3S)-3-amino-4-{[(1R)-1-benzyl-2-methoxy-2-oxoethyl]amino}-4-oxobutanoate hydrochloride (non-preferred name) |
분자식 | C15H21ClN2O5 |
분자량 | 344.7906 |
InChI | InChI=1/C15H20N2O5.ClH/c1-21-13(18)9-11(16)14(19)17-12(15(20)22-2)8-10-6-4-3-5-7-10;/h3-7,11-12H,8-9,16H2,1-2H3,(H,17,19);1H/t11-,12+;/m0./s1 |
cas번호 | 75214-12-9 |
분자 구조 | ![]() |
녹는 점 | 65℃ |
비등점 | 512.2°C at 760 mmHg |
인화점 | 263.6°C |
증기압 | 1.32E-10mmHg at 25°C |
보안 규칙 | S24/25##Avoid contact with skin and eyes.:; |
MSDS |