Chemindex > 7605-25-6
KR ▼
7605-25-6 Ethyl (phenylthio)acetate |
|
| 상품명칭 | Ethyl (phenylthio)acetate |
| 영문 이름 | Ethyl (phenylthio)acetate;Ethyl 2-(phenylthio)acetate;ethyl (phenylsulfanyl)acetate;2-(phenylsulfanyl)butanoic acid |
| 분자식 | C10H12O2S |
| 분자량 | 196.2661 |
| InChI | InChI=1/C10H12O2S/c1-2-9(10(11)12)13-8-6-4-3-5-7-8/h3-7,9H,2H2,1H3,(H,11,12) |
| cas번호 | 7605-25-6 |
| 분자 구조 |  |
| 밀도 | 1.18g/cm3 |
| 비등점 | 330.3°C at 760 mmHg |
| 굴절 지수 | 1.579 |
| 인화점 | 153.5°C |
| 증기압 | 6.74E-05mmHg at 25°C |
| 보안 규칙 | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 